C26H23F3N4O4S — CID 58311603
1-[(5Z)-5-[[1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxylic acid (PubChem CID 58311603) has the molecular formula C26H23F3N4O4S and a molecular weight of 544.56 g/mol. Its IUPAC name is 1-[(5Z)-5-[[1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(5Z)-5-[[1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 58311603 |
| Molecular Formula | C26H23F3N4O4S |
| Molecular Weight | 544.56 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | 1-[(5Z)-5-[[1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxylic acid |
| SMILES | COc1ccc(Cn2ncc3cc(/C=C4\SC(N5CCC(C(=O)O)CC5)=NC4=O)ccc32)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H23F3N4O4S/c1-37-19-4-3-17(20(12-19)26(27,28)29)14-33-21-5-2-15(10-18(21)13-30-33)11-22-23(34)31-25(38-22)32-8-6-16(7-9-32)24(35)36/h2-5,10-13,16H,6-9,14H2,1H3,(H,35,36)/b22-11- |
| InChIKey | TYHYRXQNPWMVRB-JJFYIABZSA-N |
| XLogP | 4.88 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.56 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|