C25H21F3N4O3S — CID 58311659
(2R)-1-[(5Z)-5-[[1-[[4-methyl-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]pyrrolidine-2-carboxylic acid (PubChem CID 58311659) has the molecular formula C25H21F3N4O3S and a molecular weight of 514.53 g/mol. Its IUPAC name is (2R)-1-[(5Z)-5-[[1-[[4-methyl-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[(5Z)-5-[[1-[[4-methyl-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 58311659 |
| Molecular Formula | C25H21F3N4O3S |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | (2R)-1-[(5Z)-5-[[1-[[4-methyl-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]pyrrolidine-2-carboxylic acid |
| SMILES | Cc1ccc(Cn2ncc3cc(/C=C4\SC(N5CCC[C@@H]5C(=O)O)=NC4=O)ccc32)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H21F3N4O3S/c1-14-4-6-16(18(9-14)25(26,27)28)13-32-19-7-5-15(10-17(19)12-29-32)11-21-22(33)30-24(36-21)31-8-2-3-20(31)23(34)35/h4-7,9-12,20H,2-3,8,13H2,1H3,(H,34,35)/b21-11-/t20-/m1/s1 |
| InChIKey | YZFNNGCMKKTISQ-PBMUUGLVSA-N |
| XLogP | 4.93 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|