C17H22N2O6 — CID 583119
15-benzyl-1,4,10-trioxa-7,13-diazacyclopentadecane-2,6,14-trione (PubChem CID 583119) has the molecular formula C17H22N2O6 and a molecular weight of 350.37 g/mol. Its IUPAC name is 15-benzyl-1,4,10-trioxa-7,13-diazacyclopentadecane-2,6,14-trione.
| Compound Name | 15-benzyl-1,4,10-trioxa-7,13-diazacyclopentadecane-2,6,14-trione |
|---|---|
| PubChem CID | 583119 |
| Molecular Formula | C17H22N2O6 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 15-benzyl-1,4,10-trioxa-7,13-diazacyclopentadecane-2,6,14-trione |
| SMILES | O=C1COCC(=O)OC(Cc2ccccc2)C(=O)NCCOCCN1 |
| InChI | InChI=1S/C17H22N2O6/c20-15-11-24-12-16(21)25-14(10-13-4-2-1-3-5-13)17(22)19-7-9-23-8-6-18-15/h1-5,14H,6-12H2,(H,18,20)(H,19,22) |
| InChIKey | KWRXSQNUHZQUJK-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |