About 3-methylbutyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate
3-methylbutyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate (PubChem CID 58312192) has the molecular formula C9H12F6O3
and a molecular weight of 282.18 g/mol. Its IUPAC name is 3-methylbutyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate.
Molecular Properties
| Compound Name | 3-methylbutyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate |
| PubChem CID | 58312192 |
| Molecular Formula | C9H12F6O3 |
| Molecular Weight | 282.18 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 3-methylbutyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate |
| SMILES | CC(C)CCOC(=O)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H12F6O3/c1-5(2)3-4-18-6(16)7(17,8(10,11)12)9(13,14)15/h5,17H,3-4H2,1-2H3 |
| InChIKey | JJJGQGZFKPVHIC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.18 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methylbutyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate?
The IUPAC name of 3-methylbutyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate (CID 58312192) is 3-methylbutyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate.
What is the SMILES notation for 3-methylbutyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate?
The canonical SMILES for 3-methylbutyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate is CC(C)CCOC(=O)C(O)(C(F)(F)F)C(F)(F)F.
What is the InChIKey of 3-methylbutyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate?
The InChIKey is JJJGQGZFKPVHIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F6O3/c1-5(2)3-4-18-6(16)7(17,8(10,11)12)9(13,14)15/h5,17H,3-4H2,1-2H3.
What are the key properties of 3-methylbutyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate?
3-methylbutyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate has a molecular weight of 282.18 g/mol, XLogP of 2.43, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate is sourced from PubChem (CID 58312192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).