C7H15N3 — CID 58312388
2,6-dimethyl-2,3,5,6,7,7a-hexahydro-1H-imidazo[1,2-a]imidazole (PubChem CID 58312388) has the molecular formula C7H15N3 and a molecular weight of 141.22 g/mol. Its IUPAC name is 2,6-dimethyl-2,3,5,6,7,7a-hexahydro-1H-imidazo[1,2-a]imidazole.
| Compound Name | 2,6-dimethyl-2,3,5,6,7,7a-hexahydro-1H-imidazo[1,2-a]imidazole |
|---|---|
| PubChem CID | 58312388 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | 2,6-dimethyl-2,3,5,6,7,7a-hexahydro-1H-imidazo[1,2-a]imidazole |
| SMILES | CC1CN2CC(C)NC2N1 |
| InChI | InChI=1S/C7H15N3/c1-5-3-10-4-6(2)9-7(10)8-5/h5-9H,3-4H2,1-2H3 |
| InChIKey | NIQABUMNGYFRJM-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |