C22H26N4OS — CID 58312395
N'-[2,5-dimethyl-4-[[3-[(4-methylphenyl)methyl]-1,2,4-thiadiazol-5-yl]oxy]phenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 58312395) has the molecular formula C22H26N4OS and a molecular weight of 394.54 g/mol. Its IUPAC name is N'-[2,5-dimethyl-4-[[3-[(4-methylphenyl)methyl]-1,2,4-thiadiazol-5-yl]oxy]phenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2,5-dimethyl-4-[[3-[(4-methylphenyl)methyl]-1,2,4-thiadiazol-5-yl]oxy]phenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 58312395 |
| Molecular Formula | C22H26N4OS |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | N'-[2,5-dimethyl-4-[[3-[(4-methylphenyl)methyl]-1,2,4-thiadiazol-5-yl]oxy]phenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(Oc2nc(Cc3ccc(C)cc3)ns2)cc1C |
| InChI | InChI=1S/C22H26N4OS/c1-6-26(5)14-23-19-11-17(4)20(12-16(19)3)27-22-24-21(25-28-22)13-18-9-7-15(2)8-10-18/h7-12,14H,6,13H2,1-5H3/b23-14+ |
| InChIKey | STUMFIUMGKNSGP-OEAKJJBVSA-N |
| XLogP | 5.46 |
| TPSA | 50.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|