About methyl 4-ethenylbenzoate
methyl 4-ethenylbenzoate (PubChem CID 583124) has the molecular formula C10H10O2
and a molecular weight of 162.19 g/mol. Its IUPAC name is methyl 4-ethenylbenzoate.
Molecular Properties
| Compound Name | methyl 4-ethenylbenzoate |
| PubChem CID | 583124 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | methyl 4-ethenylbenzoate |
| SMILES | C=Cc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C10H10O2/c1-3-8-4-6-9(7-5-8)10(11)12-2/h3-7H,1H2,2H3 |
| InChIKey | NUMHUJZXKZKUBN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 4-ethenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-ethenylbenzoate?
The IUPAC name of methyl 4-ethenylbenzoate (CID 583124) is methyl 4-ethenylbenzoate.
What is the SMILES notation for methyl 4-ethenylbenzoate?
The canonical SMILES for methyl 4-ethenylbenzoate is C=Cc1ccc(C(=O)OC)cc1.
What is the InChIKey of methyl 4-ethenylbenzoate?
The InChIKey is NUMHUJZXKZKUBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2/c1-3-8-4-6-9(7-5-8)10(11)12-2/h3-7H,1H2,2H3.
What are the key properties of methyl 4-ethenylbenzoate?
methyl 4-ethenylbenzoate has a molecular weight of 162.19 g/mol, XLogP of 2.12, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-ethenylbenzoate is sourced from PubChem (CID 583124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).