About 5-(4-chlorophenyl)-2,3-dimethyl-3-phenyl-1,2-oxazolidine
5-(4-chlorophenyl)-2,3-dimethyl-3-phenyl-1,2-oxazolidine (PubChem CID 58312450) has the molecular formula C17H18ClNO
and a molecular weight of 287.79 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2,3-dimethyl-3-phenyl-1,2-oxazolidine.
Molecular Properties
| Compound Name | 5-(4-chlorophenyl)-2,3-dimethyl-3-phenyl-1,2-oxazolidine |
| PubChem CID | 58312450 |
| Molecular Formula | C17H18ClNO |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 5-(4-chlorophenyl)-2,3-dimethyl-3-phenyl-1,2-oxazolidine |
| SMILES | CN1OC(c2ccc(Cl)cc2)CC1(C)c1ccccc1 |
| InChI | InChI=1S/C17H18ClNO/c1-17(14-6-4-3-5-7-14)12-16(20-19(17)2)13-8-10-15(18)11-9-13/h3-11,16H,12H2,1-2H3 |
| InChIKey | RCMPNCBDPSBNSE-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(4-chlorophenyl)-2,3-dimethyl-3-phenyl-1,2-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenyl)-2,3-dimethyl-3-phenyl-1,2-oxazolidine?
The IUPAC name of 5-(4-chlorophenyl)-2,3-dimethyl-3-phenyl-1,2-oxazolidine (CID 58312450) is 5-(4-chlorophenyl)-2,3-dimethyl-3-phenyl-1,2-oxazolidine.
What is the SMILES notation for 5-(4-chlorophenyl)-2,3-dimethyl-3-phenyl-1,2-oxazolidine?
The canonical SMILES for 5-(4-chlorophenyl)-2,3-dimethyl-3-phenyl-1,2-oxazolidine is CN1OC(c2ccc(Cl)cc2)CC1(C)c1ccccc1.
What is the InChIKey of 5-(4-chlorophenyl)-2,3-dimethyl-3-phenyl-1,2-oxazolidine?
The InChIKey is RCMPNCBDPSBNSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18ClNO/c1-17(14-6-4-3-5-7-14)12-16(20-19(17)2)13-8-10-15(18)11-9-13/h3-11,16H,12H2,1-2H3.
What are the key properties of 5-(4-chlorophenyl)-2,3-dimethyl-3-phenyl-1,2-oxazolidine?
5-(4-chlorophenyl)-2,3-dimethyl-3-phenyl-1,2-oxazolidine has a molecular weight of 287.79 g/mol, XLogP of 4.56, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenyl)-2,3-dimethyl-3-phenyl-1,2-oxazolidine is sourced from PubChem (CID 58312450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).