About (E)-2-[(5Z)-2,4-bis(ethenyl)-5-ethylidenecyclohexen-1-yl]-N,N-dimethylethenamine
(E)-2-[(5Z)-2,4-bis(ethenyl)-5-ethylidenecyclohexen-1-yl]-N,N-dimethylethenamine (PubChem CID 58312541) has the molecular formula C16H23N
and a molecular weight of 229.37 g/mol. Its IUPAC name is (E)-2-[(5Z)-2,4-bis(ethenyl)-5-ethylidenecyclohexen-1-yl]-N,N-dimethylethenamine.
Molecular Properties
| Compound Name | (E)-2-[(5Z)-2,4-bis(ethenyl)-5-ethylidenecyclohexen-1-yl]-N,N-dimethylethenamine |
| PubChem CID | 58312541 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | (E)-2-[(5Z)-2,4-bis(ethenyl)-5-ethylidenecyclohexen-1-yl]-N,N-dimethylethenamine |
| SMILES | C=CC1=C(/C=C/N(C)C)C/C(=C/C)C(C=C)C1 |
| InChI | InChI=1S/C16H23N/c1-6-13-11-15(8-3)16(9-10-17(4)5)12-14(13)7-2/h6-10,13H,1,3,11-12H2,2,4-5H3/b10-9+,14-7- |
| InChIKey | BFPZXFLMBDVGLQ-IXISGIECSA-N |
| XLogP | 4.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-[(5Z)-2,4-bis(ethenyl)-5-ethylidenecyclohexen-1-yl]-N,N-dimethylethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-[(5Z)-2,4-bis(ethenyl)-5-ethylidenecyclohexen-1-yl]-N,N-dimethylethenamine?
The IUPAC name of (E)-2-[(5Z)-2,4-bis(ethenyl)-5-ethylidenecyclohexen-1-yl]-N,N-dimethylethenamine (CID 58312541) is (E)-2-[(5Z)-2,4-bis(ethenyl)-5-ethylidenecyclohexen-1-yl]-N,N-dimethylethenamine.
What is the SMILES notation for (E)-2-[(5Z)-2,4-bis(ethenyl)-5-ethylidenecyclohexen-1-yl]-N,N-dimethylethenamine?
The canonical SMILES for (E)-2-[(5Z)-2,4-bis(ethenyl)-5-ethylidenecyclohexen-1-yl]-N,N-dimethylethenamine is C=CC1=C(/C=C/N(C)C)C/C(=C/C)C(C=C)C1.
What is the InChIKey of (E)-2-[(5Z)-2,4-bis(ethenyl)-5-ethylidenecyclohexen-1-yl]-N,N-dimethylethenamine?
The InChIKey is BFPZXFLMBDVGLQ-IXISGIECSA-N. The full InChI is InChI=1S/C16H23N/c1-6-13-11-15(8-3)16(9-10-17(4)5)12-14(13)7-2/h6-10,13H,1,3,11-12H2,2,4-5H3/b10-9+,14-7-.
What are the key properties of (E)-2-[(5Z)-2,4-bis(ethenyl)-5-ethylidenecyclohexen-1-yl]-N,N-dimethylethenamine?
(E)-2-[(5Z)-2,4-bis(ethenyl)-5-ethylidenecyclohexen-1-yl]-N,N-dimethylethenamine has a molecular weight of 229.37 g/mol, XLogP of 4.09, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-[(5Z)-2,4-bis(ethenyl)-5-ethylidenecyclohexen-1-yl]-N,N-dimethylethenamine is sourced from PubChem (CID 58312541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).