C21H18F5N5O2S — CID 58312847
(5Z)-5-[[2-[4-[3-(1,1-difluoroethyl)-5-(trifluoromethyl)phenyl]piperazin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 58312847) has the molecular formula C21H18F5N5O2S and a molecular weight of 499.47 g/mol. Its IUPAC name is (5Z)-5-[[2-[4-[3-(1,1-difluoroethyl)-5-(trifluoromethyl)phenyl]piperazin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2-[4-[3-(1,1-difluoroethyl)-5-(trifluoromethyl)phenyl]piperazin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 58312847 |
| Molecular Formula | C21H18F5N5O2S |
| Molecular Weight | 499.47 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | (5Z)-5-[[2-[4-[3-(1,1-difluoroethyl)-5-(trifluoromethyl)phenyl]piperazin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CC(F)(F)c1cc(N2CCN(c3nccc(/C=C4\SC(=O)NC4=O)n3)CC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H18F5N5O2S/c1-20(22,23)12-8-13(21(24,25)26)10-15(9-12)30-4-6-31(7-5-30)18-27-3-2-14(28-18)11-16-17(32)29-19(33)34-16/h2-3,8-11H,4-7H2,1H3,(H,29,32,33)/b16-11- |
| InChIKey | JPGCPXRYHPGRJA-WJDWOHSUSA-N |
| XLogP | 4.26 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|