C24H23FN6O2S — CID 58312851
(5Z)-5-[[2-[4-[[(8-fluoroquinolin-2-yl)methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 58312851) has the molecular formula C24H23FN6O2S and a molecular weight of 478.55 g/mol. Its IUPAC name is (5Z)-5-[[2-[4-[[(8-fluoroquinolin-2-yl)methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2-[4-[[(8-fluoroquinolin-2-yl)methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 58312851 |
| Molecular Formula | C24H23FN6O2S |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | (5Z)-5-[[2-[4-[[(8-fluoroquinolin-2-yl)methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2ccnc(N3CCC(CNCc4ccc5cccc(F)c5n4)CC3)n2)S1 |
| InChI | InChI=1S/C24H23FN6O2S/c25-19-3-1-2-16-4-5-18(28-21(16)19)14-26-13-15-7-10-31(11-8-15)23-27-9-6-17(29-23)12-20-22(32)30-24(33)34-20/h1-6,9,12,15,26H,7-8,10-11,13-14H2,(H,30,32,33)/b20-12- |
| InChIKey | GZZGKFYQUJIAPI-NDENLUEZSA-N |
| XLogP | 3.49 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|