C24H24N6O2S — CID 58312866
(5Z)-5-[[2-[4-[(1,8-naphthyridin-2-ylmethylamino)methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]thiolane-2,4-dione (PubChem CID 58312866) has the molecular formula C24H24N6O2S and a molecular weight of 460.56 g/mol. Its IUPAC name is (5Z)-5-[[2-[4-[(1,8-naphthyridin-2-ylmethylamino)methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]thiolane-2,4-dione.
| Compound Name | (5Z)-5-[[2-[4-[(1,8-naphthyridin-2-ylmethylamino)methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]thiolane-2,4-dione |
|---|---|
| PubChem CID | 58312866 |
| Molecular Formula | C24H24N6O2S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | (5Z)-5-[[2-[4-[(1,8-naphthyridin-2-ylmethylamino)methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]thiolane-2,4-dione |
| SMILES | O=C1CC(=O)/C(=C/c2ccnc(N3CCC(CNCc4ccc5cccnc5n4)CC3)n2)S1 |
| InChI | InChI=1S/C24H24N6O2S/c31-20-13-22(32)33-21(20)12-18-5-9-27-24(29-18)30-10-6-16(7-11-30)14-25-15-19-4-3-17-2-1-8-26-23(17)28-19/h1-5,8-9,12,16,25H,6-7,10-11,13-15H2/b21-12- |
| InChIKey | WYSOTCZUNRIZBK-MTJSOVHGSA-N |
| XLogP | 3.00 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|