C20H15F6N5O2S — CID 58312916
(5Z)-5-[[2-[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 58312916) has the molecular formula C20H15F6N5O2S and a molecular weight of 503.43 g/mol. Its IUPAC name is (5Z)-5-[[2-[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2-[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 58312916 |
| Molecular Formula | C20H15F6N5O2S |
| Molecular Weight | 503.43 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | (5Z)-5-[[2-[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2ccnc(N3CCN(c4cc(C(F)(F)F)cc(C(F)(F)F)c4)CC3)n2)S1 |
| InChI | InChI=1S/C20H15F6N5O2S/c21-19(22,23)11-7-12(20(24,25)26)9-14(8-11)30-3-5-31(6-4-30)17-27-2-1-13(28-17)10-15-16(32)29-18(33)34-15/h1-2,7-10H,3-6H2,(H,29,32,33)/b15-10- |
| InChIKey | DCJAMEBORAMOBC-GDNBJRDFSA-N |
| XLogP | 4.16 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|