C19H24N4O2S — CID 58312941
(5Z)-5-[[2-(8-methyl-2,8-diazaspiro[5.5]undecan-2-yl)pyrimidin-4-yl]methylidene]thiolane-2,4-dione (PubChem CID 58312941) has the molecular formula C19H24N4O2S and a molecular weight of 372.49 g/mol. Its IUPAC name is (5Z)-5-[[2-(8-methyl-2,8-diazaspiro[5.5]undecan-2-yl)pyrimidin-4-yl]methylidene]thiolane-2,4-dione.
| Compound Name | (5Z)-5-[[2-(8-methyl-2,8-diazaspiro[5.5]undecan-2-yl)pyrimidin-4-yl]methylidene]thiolane-2,4-dione |
|---|---|
| PubChem CID | 58312941 |
| Molecular Formula | C19H24N4O2S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | (5Z)-5-[[2-(8-methyl-2,8-diazaspiro[5.5]undecan-2-yl)pyrimidin-4-yl]methylidene]thiolane-2,4-dione |
| SMILES | CN1CCCC2(CCCN(c3nccc(/C=C4\SC(=O)CC4=O)n3)C2)C1 |
| InChI | InChI=1S/C19H24N4O2S/c1-22-8-2-5-19(12-22)6-3-9-23(13-19)18-20-7-4-14(21-18)10-16-15(24)11-17(25)26-16/h4,7,10H,2-3,5-6,8-9,11-13H2,1H3/b16-10- |
| InChIKey | CVDLHWMTBSFQRO-YBEGLDIGSA-N |
| XLogP | 2.36 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|