C23H21FN6O2S — CID 58312948
(5Z)-5-[[2-[(3S)-3-[(6-fluoroquinolin-2-yl)methylamino]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 58312948) has the molecular formula C23H21FN6O2S and a molecular weight of 464.53 g/mol. Its IUPAC name is (5Z)-5-[[2-[(3S)-3-[(6-fluoroquinolin-2-yl)methylamino]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2-[(3S)-3-[(6-fluoroquinolin-2-yl)methylamino]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 58312948 |
| Molecular Formula | C23H21FN6O2S |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | (5Z)-5-[[2-[(3S)-3-[(6-fluoroquinolin-2-yl)methylamino]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2ccnc(N3CCC[C@H](NCc4ccc5cc(F)ccc5n4)C3)n2)S1 |
| InChI | InChI=1S/C23H21FN6O2S/c24-15-4-6-19-14(10-15)3-5-17(27-19)12-26-18-2-1-9-30(13-18)22-25-8-7-16(28-22)11-20-21(31)29-23(32)33-20/h3-8,10-11,18,26H,1-2,9,12-13H2,(H,29,31,32)/b20-11-/t18-/m0/s1 |
| InChIKey | KEOHJFGIQJTXFH-ISRVBRPNSA-N |
| XLogP | 3.25 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|