About 3-chlorotricyclo[5.2.1.04,8]deca-2,5-diene
3-chlorotricyclo[5.2.1.04,8]deca-2,5-diene (PubChem CID 583131) has the molecular formula C10H11Cl
and a molecular weight of 166.65 g/mol. Its IUPAC name is 3-chlorotricyclo[5.2.1.04,8]deca-2,5-diene.
Molecular Properties
| Compound Name | 3-chlorotricyclo[5.2.1.04,8]deca-2,5-diene |
| PubChem CID | 583131 |
| Molecular Formula | C10H11Cl |
| Molecular Weight | 166.65 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 3-chlorotricyclo[5.2.1.04,8]deca-2,5-diene |
| SMILES | ClC1=CC2CC3C=CC1C3C2 |
| InChI | InChI=1S/C10H11Cl/c11-10-5-6-3-7-1-2-8(10)9(7)4-6/h1-2,5-9H,3-4H2 |
| InChIKey | KJZHQLPIHWRCCB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.65 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-chlorotricyclo[5.2.1.04,8]deca-2,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chlorotricyclo[5.2.1.04,8]deca-2,5-diene?
The IUPAC name of 3-chlorotricyclo[5.2.1.04,8]deca-2,5-diene (CID 583131) is 3-chlorotricyclo[5.2.1.04,8]deca-2,5-diene.
What is the SMILES notation for 3-chlorotricyclo[5.2.1.04,8]deca-2,5-diene?
The canonical SMILES for 3-chlorotricyclo[5.2.1.04,8]deca-2,5-diene is ClC1=CC2CC3C=CC1C3C2.
What is the InChIKey of 3-chlorotricyclo[5.2.1.04,8]deca-2,5-diene?
The InChIKey is KJZHQLPIHWRCCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11Cl/c11-10-5-6-3-7-1-2-8(10)9(7)4-6/h1-2,5-9H,3-4H2.
What are the key properties of 3-chlorotricyclo[5.2.1.04,8]deca-2,5-diene?
3-chlorotricyclo[5.2.1.04,8]deca-2,5-diene has a molecular weight of 166.65 g/mol, XLogP of 2.95, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chlorotricyclo[5.2.1.04,8]deca-2,5-diene is sourced from PubChem (CID 583131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).