C31H42N4O2 — CID 58313210
N-(azepan-1-yl)-4-[(3-hydroxyphenyl)-(3-prop-2-enyl-3,10-diazabicyclo[4.3.1]decan-10-yl)methyl]benzamide (PubChem CID 58313210) has the molecular formula C31H42N4O2 and a molecular weight of 502.70 g/mol. Its IUPAC name is N-(azepan-1-yl)-4-[(3-hydroxyphenyl)-(3-prop-2-enyl-3,10-diazabicyclo[4.3.1]decan-10-yl)methyl]benzamide.
| Compound Name | N-(azepan-1-yl)-4-[(3-hydroxyphenyl)-(3-prop-2-enyl-3,10-diazabicyclo[4.3.1]decan-10-yl)methyl]benzamide |
|---|---|
| PubChem CID | 58313210 |
| Molecular Formula | C31H42N4O2 |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.33 |
| IUPAC Name | N-(azepan-1-yl)-4-[(3-hydroxyphenyl)-(3-prop-2-enyl-3,10-diazabicyclo[4.3.1]decan-10-yl)methyl]benzamide |
| SMILES | C=CCN1CCC2CCCC(C1)N2C(c1ccc(C(=O)NN2CCCCCC2)cc1)c1cccc(O)c1 |
| InChI | InChI=1S/C31H42N4O2/c1-2-18-33-21-17-27-10-8-11-28(23-33)35(27)30(26-9-7-12-29(36)22-26)24-13-15-25(16-14-24)31(37)32-34-19-5-3-4-6-20-34/h2,7,9,12-16,22,27-28,30,36H,1,3-6,8,10-11,17-21,23H2,(H,32,37) |
| InChIKey | CMIWSAZGTAJRPT-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 59.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|