C29H39N3O2 — CID 58313311
N,N-diethyl-3-(3-hydroxyphenyl)-4-[(3-prop-2-enyl-3,10-diazabicyclo[4.3.1]decan-10-yl)methyl]benzamide (PubChem CID 58313311) has the molecular formula C29H39N3O2 and a molecular weight of 461.65 g/mol. Its IUPAC name is N,N-diethyl-3-(3-hydroxyphenyl)-4-[(3-prop-2-enyl-3,10-diazabicyclo[4.3.1]decan-10-yl)methyl]benzamide.
| Compound Name | N,N-diethyl-3-(3-hydroxyphenyl)-4-[(3-prop-2-enyl-3,10-diazabicyclo[4.3.1]decan-10-yl)methyl]benzamide |
|---|---|
| PubChem CID | 58313311 |
| Molecular Formula | C29H39N3O2 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.30 |
| IUPAC Name | N,N-diethyl-3-(3-hydroxyphenyl)-4-[(3-prop-2-enyl-3,10-diazabicyclo[4.3.1]decan-10-yl)methyl]benzamide |
| SMILES | C=CCN1CCC2CCCC(C1)N2Cc1ccc(C(=O)N(CC)CC)cc1-c1cccc(O)c1 |
| InChI | InChI=1S/C29H39N3O2/c1-4-16-30-17-15-25-10-8-11-26(21-30)32(25)20-24-14-13-23(29(34)31(5-2)6-3)19-28(24)22-9-7-12-27(33)18-22/h4,7,9,12-14,18-19,25-26,33H,1,5-6,8,10-11,15-17,20-21H2,2-3H3 |
| InChIKey | MJZHOCDZAFPRLE-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|