C30H40N4O2 — CID 58313399
N-(azepan-1-yl)-4-[(3-hydroxyphenyl)-(3-prop-2-enyl-3,9-diazabicyclo[4.2.1]nonan-9-yl)methyl]benzamide (PubChem CID 58313399) has the molecular formula C30H40N4O2 and a molecular weight of 488.68 g/mol. Its IUPAC name is N-(azepan-1-yl)-4-[(3-hydroxyphenyl)-(3-prop-2-enyl-3,9-diazabicyclo[4.2.1]nonan-9-yl)methyl]benzamide.
| Compound Name | N-(azepan-1-yl)-4-[(3-hydroxyphenyl)-(3-prop-2-enyl-3,9-diazabicyclo[4.2.1]nonan-9-yl)methyl]benzamide |
|---|---|
| PubChem CID | 58313399 |
| Molecular Formula | C30H40N4O2 |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.32 |
| IUPAC Name | N-(azepan-1-yl)-4-[(3-hydroxyphenyl)-(3-prop-2-enyl-3,9-diazabicyclo[4.2.1]nonan-9-yl)methyl]benzamide |
| SMILES | C=CCN1CCC2CCC(C1)N2C(c1ccc(C(=O)NN2CCCCCC2)cc1)c1cccc(O)c1 |
| InChI | InChI=1S/C30H40N4O2/c1-2-17-32-20-16-26-14-15-27(22-32)34(26)29(25-8-7-9-28(35)21-25)23-10-12-24(13-11-23)30(36)31-33-18-5-3-4-6-19-33/h2,7-13,21,26-27,29,35H,1,3-6,14-20,22H2,(H,31,36) |
| InChIKey | LQYCZQZUQPDIBC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 59.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|