C30H39N3O2 — CID 58313465
N,N-diethyl-4-[(3-methoxyphenyl)-(7-prop-2-enyl-2,7-diazatricyclo[4.4.0.03,8]decan-2-yl)methyl]benzamide (PubChem CID 58313465) has the molecular formula C30H39N3O2 and a molecular weight of 473.66 g/mol. Its IUPAC name is N,N-diethyl-4-[(3-methoxyphenyl)-(7-prop-2-enyl-2,7-diazatricyclo[4.4.0.03,8]decan-2-yl)methyl]benzamide.
| Compound Name | N,N-diethyl-4-[(3-methoxyphenyl)-(7-prop-2-enyl-2,7-diazatricyclo[4.4.0.03,8]decan-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 58313465 |
| Molecular Formula | C30H39N3O2 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.30 |
| IUPAC Name | N,N-diethyl-4-[(3-methoxyphenyl)-(7-prop-2-enyl-2,7-diazatricyclo[4.4.0.03,8]decan-2-yl)methyl]benzamide |
| SMILES | C=CCN1C2CCC3C1CCC2N3C(c1ccc(C(=O)N(CC)CC)cc1)c1cccc(OC)c1 |
| InChI | InChI=1S/C30H39N3O2/c1-5-19-32-25-15-17-27-26(32)16-18-28(25)33(27)29(23-9-8-10-24(20-23)35-4)21-11-13-22(14-12-21)30(34)31(6-2)7-3/h5,8-14,20,25-29H,1,6-7,15-19H2,2-4H3 |
| InChIKey | KQEYTZSMSGHBQI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|