C16H28N2O3 — CID 58313473
2-[3-(4-methylpentyl)-2,5-dioxopyrrolidin-1-yl]-N-(2-methylpropyl)acetamide (PubChem CID 58313473) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is 2-[3-(4-methylpentyl)-2,5-dioxopyrrolidin-1-yl]-N-(2-methylpropyl)acetamide.
| Compound Name | 2-[3-(4-methylpentyl)-2,5-dioxopyrrolidin-1-yl]-N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 58313473 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 2-[3-(4-methylpentyl)-2,5-dioxopyrrolidin-1-yl]-N-(2-methylpropyl)acetamide |
| SMILES | CC(C)CCCC1CC(=O)N(CC(=O)NCC(C)C)C1=O |
| InChI | InChI=1S/C16H28N2O3/c1-11(2)6-5-7-13-8-15(20)18(16(13)21)10-14(19)17-9-12(3)4/h11-13H,5-10H2,1-4H3,(H,17,19) |
| InChIKey | QVKGQCKMOXMFAA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|