C16H16F3N7O2 — CID 58313733
(3E)-3-[[2-(cyclopropylmethylamino)-4-(2,2,2-trifluoroethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58313733) has the molecular formula C16H16F3N7O2 and a molecular weight of 395.35 g/mol. Its IUPAC name is (3E)-3-[[2-(cyclopropylmethylamino)-4-(2,2,2-trifluoroethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[2-(cyclopropylmethylamino)-4-(2,2,2-trifluoroethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58313733 |
| Molecular Formula | C16H16F3N7O2 |
| Molecular Weight | 395.35 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | (3E)-3-[[2-(cyclopropylmethylamino)-4-(2,2,2-trifluoroethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(NCC(F)(F)F)nc(NCC4CC4)nc23)C(=O)N1 |
| InChI | InChI=1S/C16H16F3N7O2/c17-16(18,19)7-21-15-25-14(20-5-8-1-2-8)24-12-10(6-22-26(12)15)3-9-4-11(27)23-13(9)28/h3,6,8H,1-2,4-5,7H2,(H,23,27,28)(H2,20,21,24,25)/b9-3+ |
| InChIKey | NJHWUWRVSBVIAT-YCRREMRBSA-N |
| XLogP | 1.35 |
| TPSA | 113.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|