C25H31N9O3 — CID 58313771
(3E)-3-[[4-(2-ethoxyethylamino)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58313771) has the molecular formula C25H31N9O3 and a molecular weight of 505.58 g/mol. Its IUPAC name is (3E)-3-[[4-(2-ethoxyethylamino)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-(2-ethoxyethylamino)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58313771 |
| Molecular Formula | C25H31N9O3 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | (3E)-3-[[4-(2-ethoxyethylamino)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | CCOCCNc1nc(Nc2ccc(N3CCN(C)CC3)cc2)nc2c(/C=C3\CC(=O)NC3=O)cnn12 |
| InChI | InChI=1S/C25H31N9O3/c1-3-37-13-8-26-25-31-24(28-19-4-6-20(7-5-19)33-11-9-32(2)10-12-33)30-22-18(16-27-34(22)25)14-17-15-21(35)29-23(17)36/h4-7,14,16H,3,8-13,15H2,1-2H3,(H,29,35,36)(H2,26,28,30,31)/b17-14+ |
| InChIKey | XTKHLKDTBZIMOV-SAPNQHFASA-N |
| XLogP | 1.50 |
| TPSA | 129.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|