C24H23FN6O4 — CID 58313784
ethyl 3-[[7-(cyclopropylmethylamino)-3-[(E)-(2,5-dioxopyrrolidin-3-ylidene)methyl]pyrazolo[1,5-a]pyrimidin-5-yl]amino]-5-fluorobenzoate (PubChem CID 58313784) has the molecular formula C24H23FN6O4 and a molecular weight of 478.48 g/mol. Its IUPAC name is ethyl 3-[[7-(cyclopropylmethylamino)-3-[(E)-(2,5-dioxopyrrolidin-3-ylidene)methyl]pyrazolo[1,5-a]pyrimidin-5-yl]amino]-5-fluorobenzoate.
| Compound Name | ethyl 3-[[7-(cyclopropylmethylamino)-3-[(E)-(2,5-dioxopyrrolidin-3-ylidene)methyl]pyrazolo[1,5-a]pyrimidin-5-yl]amino]-5-fluorobenzoate |
|---|---|
| PubChem CID | 58313784 |
| Molecular Formula | C24H23FN6O4 |
| Molecular Weight | 478.48 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | ethyl 3-[[7-(cyclopropylmethylamino)-3-[(E)-(2,5-dioxopyrrolidin-3-ylidene)methyl]pyrazolo[1,5-a]pyrimidin-5-yl]amino]-5-fluorobenzoate |
| SMILES | CCOC(=O)c1cc(F)cc(Nc2cc(NCC3CC3)n3ncc(/C=C4\CC(=O)NC4=O)c3n2)c1 |
| InChI | InChI=1S/C24H23FN6O4/c1-2-35-24(34)15-6-17(25)9-18(7-15)28-19-10-20(26-11-13-3-4-13)31-22(29-19)16(12-27-31)5-14-8-21(32)30-23(14)33/h5-7,9-10,12-13,26H,2-4,8,11H2,1H3,(H,28,29)(H,30,32,33)/b14-5+ |
| InChIKey | NMGQHVSGDQFGIG-LHHJGKSTSA-N |
| XLogP | 3.04 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|