C16H15F4N7O2 — CID 58313790
(3E)-3-[[2-[(3R)-3-fluoropyrrolidin-1-yl]-4-(2,2,2-trifluoroethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58313790) has the molecular formula C16H15F4N7O2 and a molecular weight of 413.34 g/mol. Its IUPAC name is (3E)-3-[[2-[(3R)-3-fluoropyrrolidin-1-yl]-4-(2,2,2-trifluoroethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[2-[(3R)-3-fluoropyrrolidin-1-yl]-4-(2,2,2-trifluoroethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58313790 |
| Molecular Formula | C16H15F4N7O2 |
| Molecular Weight | 413.34 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | (3E)-3-[[2-[(3R)-3-fluoropyrrolidin-1-yl]-4-(2,2,2-trifluoroethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(NCC(F)(F)F)nc(N4CC[C@@H](F)C4)nc23)C(=O)N1 |
| InChI | InChI=1S/C16H15F4N7O2/c17-10-1-2-26(6-10)15-24-12-9(3-8-4-11(28)23-13(8)29)5-22-27(12)14(25-15)21-7-16(18,19)20/h3,5,10H,1-2,4,6-7H2,(H,21,24,25)(H,23,28,29)/b8-3+/t10-/m1/s1 |
| InChIKey | KIQUZRFIAVMQQP-SIUBYYJGSA-N |
| XLogP | 1.08 |
| TPSA | 104.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|