C24H26N8O3 — CID 58313863
(3E)-3-[[7-(cyclopropylamino)-5-[(2-morpholin-4-yl-4-pyridinyl)methylamino]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58313863) has the molecular formula C24H26N8O3 and a molecular weight of 474.53 g/mol. Its IUPAC name is (3E)-3-[[7-(cyclopropylamino)-5-[(2-morpholin-4-yl-4-pyridinyl)methylamino]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[7-(cyclopropylamino)-5-[(2-morpholin-4-yl-4-pyridinyl)methylamino]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58313863 |
| Molecular Formula | C24H26N8O3 |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | (3E)-3-[[7-(cyclopropylamino)-5-[(2-morpholin-4-yl-4-pyridinyl)methylamino]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(NC4CC4)cc(NCc4ccnc(N5CCOCC5)c4)nc23)C(=O)N1 |
| InChI | InChI=1S/C24H26N8O3/c33-22-11-16(24(34)30-22)10-17-14-27-32-21(28-18-1-2-18)12-19(29-23(17)32)26-13-15-3-4-25-20(9-15)31-5-7-35-8-6-31/h3-4,9-10,12,14,18,28H,1-2,5-8,11,13H2,(H,26,29)(H,30,33,34)/b16-10+ |
| InChIKey | JIYZZDZGAATKSA-MHWRWJLKSA-N |
| XLogP | 1.58 |
| TPSA | 125.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|