C20H17F2N7O2 — CID 58313898
(3E)-3-[[4-(cyclopropylamino)-2-[(2,3-difluorophenyl)methylamino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58313898) has the molecular formula C20H17F2N7O2 and a molecular weight of 425.40 g/mol. Its IUPAC name is (3E)-3-[[4-(cyclopropylamino)-2-[(2,3-difluorophenyl)methylamino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-(cyclopropylamino)-2-[(2,3-difluorophenyl)methylamino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58313898 |
| Molecular Formula | C20H17F2N7O2 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | (3E)-3-[[4-(cyclopropylamino)-2-[(2,3-difluorophenyl)methylamino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(NC4CC4)nc(NCc4cccc(F)c4F)nc23)C(=O)N1 |
| InChI | InChI=1S/C20H17F2N7O2/c21-14-3-1-2-10(16(14)22)8-23-19-27-17-12(6-11-7-15(30)26-18(11)31)9-24-29(17)20(28-19)25-13-4-5-13/h1-3,6,9,13H,4-5,7-8H2,(H,26,30,31)(H2,23,25,27,28)/b11-6+ |
| InChIKey | BZUUQWVVDKBUTO-IZZDOVSWSA-N |
| XLogP | 2.02 |
| TPSA | 113.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|