C27H22F3N7O3 — CID 58314029
(3E)-3-[[4-(cyclopropylamino)-2-[[2-[3-(trifluoromethoxy)phenyl]phenyl]methylamino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58314029) has the molecular formula C27H22F3N7O3 and a molecular weight of 549.51 g/mol. Its IUPAC name is (3E)-3-[[4-(cyclopropylamino)-2-[[2-[3-(trifluoromethoxy)phenyl]phenyl]methylamino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-(cyclopropylamino)-2-[[2-[3-(trifluoromethoxy)phenyl]phenyl]methylamino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58314029 |
| Molecular Formula | C27H22F3N7O3 |
| Molecular Weight | 549.51 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | (3E)-3-[[4-(cyclopropylamino)-2-[[2-[3-(trifluoromethoxy)phenyl]phenyl]methylamino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(NC4CC4)nc(NCc4ccccc4-c4cccc(OC(F)(F)F)c4)nc23)C(=O)N1 |
| InChI | InChI=1S/C27H22F3N7O3/c28-27(29,30)40-20-6-3-5-15(11-20)21-7-2-1-4-16(21)13-31-25-35-23-18(10-17-12-22(38)34-24(17)39)14-32-37(23)26(36-25)33-19-8-9-19/h1-7,10-11,14,19H,8-9,12-13H2,(H,34,38,39)(H2,31,33,35,36)/b17-10+ |
| InChIKey | GAANPTCAJLXYQF-LICLKQGHSA-N |
| XLogP | 4.31 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|