C23H28F3N7O4S — CID 58314038
(3E)-3-[[4-(cyclopropylamino)-2-[[4-(3,3,3-trifluoropropylsulfonylmethyl)cyclohexyl]amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58314038) has the molecular formula C23H28F3N7O4S and a molecular weight of 555.58 g/mol. Its IUPAC name is (3E)-3-[[4-(cyclopropylamino)-2-[[4-(3,3,3-trifluoropropylsulfonylmethyl)cyclohexyl]amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-(cyclopropylamino)-2-[[4-(3,3,3-trifluoropropylsulfonylmethyl)cyclohexyl]amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58314038 |
| Molecular Formula | C23H28F3N7O4S |
| Molecular Weight | 555.58 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | (3E)-3-[[4-(cyclopropylamino)-2-[[4-(3,3,3-trifluoropropylsulfonylmethyl)cyclohexyl]amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(NC4CC4)nc(NC4CCC(CS(=O)(=O)CCC(F)(F)F)CC4)nc23)C(=O)N1 |
| InChI | InChI=1S/C23H28F3N7O4S/c24-23(25,26)7-8-38(36,37)12-13-1-3-16(4-2-13)28-21-31-19-15(9-14-10-18(34)30-20(14)35)11-27-33(19)22(32-21)29-17-5-6-17/h9,11,13,16-17H,1-8,10,12H2,(H,30,34,35)(H2,28,29,31,32)/b14-9+ |
| InChIKey | JGYSXNQFAMYUPT-NTEUORMPSA-N |
| XLogP | 2.47 |
| TPSA | 147.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.58 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|