C20H18ClN7O3 — CID 58314048
(3E)-3-[[2-(3-chloro-4-methoxyanilino)-4-(cyclopropylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58314048) has the molecular formula C20H18ClN7O3 and a molecular weight of 439.86 g/mol. Its IUPAC name is (3E)-3-[[2-(3-chloro-4-methoxyanilino)-4-(cyclopropylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[2-(3-chloro-4-methoxyanilino)-4-(cyclopropylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58314048 |
| Molecular Formula | C20H18ClN7O3 |
| Molecular Weight | 439.86 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | (3E)-3-[[2-(3-chloro-4-methoxyanilino)-4-(cyclopropylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | COc1ccc(Nc2nc(NC3CC3)n3ncc(/C=C4\CC(=O)NC4=O)c3n2)cc1Cl |
| InChI | InChI=1S/C20H18ClN7O3/c1-31-15-5-4-13(8-14(15)21)23-19-26-17-11(6-10-7-16(29)25-18(10)30)9-22-28(17)20(27-19)24-12-2-3-12/h4-6,8-9,12H,2-3,7H2,1H3,(H,25,29,30)(H2,23,24,26,27)/b10-6+ |
| InChIKey | MFKRAKRKAZFMMH-UXBLZVDNSA-N |
| XLogP | 2.53 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.86 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|