C19H22N6O2 — CID 58314229
(3E)-3-[[5,7-bis(cyclopropylmethylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58314229) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is (3E)-3-[[5,7-bis(cyclopropylmethylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[5,7-bis(cyclopropylmethylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58314229 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | (3E)-3-[[5,7-bis(cyclopropylmethylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(NCC4CC4)cc(NCC4CC4)nc23)C(=O)N1 |
| InChI | InChI=1S/C19H22N6O2/c26-17-6-13(19(27)24-17)5-14-10-22-25-16(21-9-12-3-4-12)7-15(23-18(14)25)20-8-11-1-2-11/h5,7,10-12,21H,1-4,6,8-9H2,(H,20,23)(H,24,26,27)/b13-5+ |
| InChIKey | WEGJPOAONHIHDB-WLRTZDKTSA-N |
| XLogP | 1.80 |
| TPSA | 100.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|