C21H19FN6O2 — CID 58314272
(3E)-3-[[7-(cyclopropylamino)-5-(2-fluoroanilino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]-1-methylpyrrolidine-2,5-dione (PubChem CID 58314272) has the molecular formula C21H19FN6O2 and a molecular weight of 406.42 g/mol. Its IUPAC name is (3E)-3-[[7-(cyclopropylamino)-5-(2-fluoroanilino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]-1-methylpyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[7-(cyclopropylamino)-5-(2-fluoroanilino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]-1-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58314272 |
| Molecular Formula | C21H19FN6O2 |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | (3E)-3-[[7-(cyclopropylamino)-5-(2-fluoroanilino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]-1-methylpyrrolidine-2,5-dione |
| SMILES | CN1C(=O)C/C(=C\c2cnn3c(NC4CC4)cc(Nc4ccccc4F)nc23)C1=O |
| InChI | InChI=1S/C21H19FN6O2/c1-27-19(29)9-12(21(27)30)8-13-11-23-28-18(24-14-6-7-14)10-17(26-20(13)28)25-16-5-3-2-4-15(16)22/h2-5,8,10-11,14,24H,6-7,9H2,1H3,(H,25,26)/b12-8+ |
| InChIKey | DYLRQOXGOJOQNH-XYOKQWHBSA-N |
| XLogP | 2.96 |
| TPSA | 91.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|