C23H25N7O3 — CID 58314344
(3E)-3-[[4-(cyclopropylamino)-2-[3-(diethylamino)phenoxy]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58314344) has the molecular formula C23H25N7O3 and a molecular weight of 447.50 g/mol. Its IUPAC name is (3E)-3-[[4-(cyclopropylamino)-2-[3-(diethylamino)phenoxy]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-(cyclopropylamino)-2-[3-(diethylamino)phenoxy]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58314344 |
| Molecular Formula | C23H25N7O3 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | (3E)-3-[[4-(cyclopropylamino)-2-[3-(diethylamino)phenoxy]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | CCN(CC)c1cccc(Oc2nc(NC3CC3)n3ncc(/C=C4\CC(=O)NC4=O)c3n2)c1 |
| InChI | InChI=1S/C23H25N7O3/c1-3-29(4-2)17-6-5-7-18(12-17)33-23-27-20-15(10-14-11-19(31)26-21(14)32)13-24-30(20)22(28-23)25-16-8-9-16/h5-7,10,12-13,16H,3-4,8-9,11H2,1-2H3,(H,25,27,28)(H,26,31,32)/b14-10+ |
| InChIKey | VJBLNHMHUXQXNT-GXDHUFHOSA-N |
| XLogP | 2.77 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|