C19H20F3N7O2 — CID 58314361
(3E)-3-[[4-(cyclopropylamino)-2-[3-(trifluoromethyl)piperidin-1-yl]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58314361) has the molecular formula C19H20F3N7O2 and a molecular weight of 435.41 g/mol. Its IUPAC name is (3E)-3-[[4-(cyclopropylamino)-2-[3-(trifluoromethyl)piperidin-1-yl]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-(cyclopropylamino)-2-[3-(trifluoromethyl)piperidin-1-yl]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58314361 |
| Molecular Formula | C19H20F3N7O2 |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | (3E)-3-[[4-(cyclopropylamino)-2-[3-(trifluoromethyl)piperidin-1-yl]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(NC4CC4)nc(N4CCCC(C(F)(F)F)C4)nc23)C(=O)N1 |
| InChI | InChI=1S/C19H20F3N7O2/c20-19(21,22)12-2-1-5-28(9-12)17-26-15-11(6-10-7-14(30)25-16(10)31)8-23-29(15)18(27-17)24-13-3-4-13/h6,8,12-13H,1-5,7,9H2,(H,24,26,27)(H,25,30,31)/b10-6+ |
| InChIKey | LBPMWGANMTXHDC-UXBLZVDNSA-N |
| XLogP | 1.91 |
| TPSA | 104.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|