C17H18F3N7O2 — CID 58314408
(3E)-3-[[2-(cyclopentylamino)-4-(2,2,2-trifluoroethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58314408) has the molecular formula C17H18F3N7O2 and a molecular weight of 409.37 g/mol. Its IUPAC name is (3E)-3-[[2-(cyclopentylamino)-4-(2,2,2-trifluoroethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[2-(cyclopentylamino)-4-(2,2,2-trifluoroethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58314408 |
| Molecular Formula | C17H18F3N7O2 |
| Molecular Weight | 409.37 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | (3E)-3-[[2-(cyclopentylamino)-4-(2,2,2-trifluoroethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(NCC(F)(F)F)nc(NC4CCCC4)nc23)C(=O)N1 |
| InChI | InChI=1S/C17H18F3N7O2/c18-17(19,20)8-21-16-26-15(23-11-3-1-2-4-11)25-13-10(7-22-27(13)16)5-9-6-12(28)24-14(9)29/h5,7,11H,1-4,6,8H2,(H,24,28,29)(H2,21,23,25,26)/b9-5+ |
| InChIKey | SMKGJZZTGVLACV-WEVVVXLNSA-N |
| XLogP | 1.88 |
| TPSA | 113.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|