C26H30N8O3 — CID 58314448
(3E)-3-[[4-(cyclopropylamino)-2-[4-(4-propan-2-ylpiperazin-1-yl)phenoxy]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58314448) has the molecular formula C26H30N8O3 and a molecular weight of 502.58 g/mol. Its IUPAC name is (3E)-3-[[4-(cyclopropylamino)-2-[4-(4-propan-2-ylpiperazin-1-yl)phenoxy]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-(cyclopropylamino)-2-[4-(4-propan-2-ylpiperazin-1-yl)phenoxy]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58314448 |
| Molecular Formula | C26H30N8O3 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | (3E)-3-[[4-(cyclopropylamino)-2-[4-(4-propan-2-ylpiperazin-1-yl)phenoxy]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | CC(C)N1CCN(c2ccc(Oc3nc(NC4CC4)n4ncc(/C=C5\CC(=O)NC5=O)c4n3)cc2)CC1 |
| InChI | InChI=1S/C26H30N8O3/c1-16(2)32-9-11-33(12-10-32)20-5-7-21(8-6-20)37-26-30-23-18(13-17-14-22(35)29-24(17)36)15-27-34(23)25(31-26)28-19-3-4-19/h5-8,13,15-16,19H,3-4,9-12,14H2,1-2H3,(H,28,30,31)(H,29,35,36)/b17-13+ |
| InChIKey | FWLYLQPAVKIROE-GHRIWEEISA-N |
| XLogP | 2.45 |
| TPSA | 116.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|