C24H26N8O3 — CID 58314522
(3E)-3-[[4-(cyclopropylamino)-2-[3-(morpholin-4-ylmethyl)anilino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58314522) has the molecular formula C24H26N8O3 and a molecular weight of 474.53 g/mol. Its IUPAC name is (3E)-3-[[4-(cyclopropylamino)-2-[3-(morpholin-4-ylmethyl)anilino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-(cyclopropylamino)-2-[3-(morpholin-4-ylmethyl)anilino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58314522 |
| Molecular Formula | C24H26N8O3 |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | (3E)-3-[[4-(cyclopropylamino)-2-[3-(morpholin-4-ylmethyl)anilino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(NC4CC4)nc(Nc4cccc(CN5CCOCC5)c4)nc23)C(=O)N1 |
| InChI | InChI=1S/C24H26N8O3/c33-20-12-16(22(34)28-20)11-17-13-25-32-21(17)29-23(30-24(32)27-18-4-5-18)26-19-3-1-2-15(10-19)14-31-6-8-35-9-7-31/h1-3,10-11,13,18H,4-9,12,14H2,(H,28,33,34)(H2,26,27,29,30)/b16-11+ |
| InChIKey | ZNUZRQSRCLMFQZ-LFIBNONCSA-N |
| XLogP | 1.70 |
| TPSA | 125.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|