C19H20F2N6O2 — CID 58314536
(3E)-3-[[7-(cyclopropylamino)-5-(4,4-difluoropiperidin-1-yl)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58314536) has the molecular formula C19H20F2N6O2 and a molecular weight of 402.41 g/mol. Its IUPAC name is (3E)-3-[[7-(cyclopropylamino)-5-(4,4-difluoropiperidin-1-yl)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[7-(cyclopropylamino)-5-(4,4-difluoropiperidin-1-yl)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58314536 |
| Molecular Formula | C19H20F2N6O2 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | (3E)-3-[[7-(cyclopropylamino)-5-(4,4-difluoropiperidin-1-yl)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(NC4CC4)cc(N4CCC(F)(F)CC4)nc23)C(=O)N1 |
| InChI | InChI=1S/C19H20F2N6O2/c20-19(21)3-5-26(6-4-19)14-9-15(23-13-1-2-13)27-17(24-14)12(10-22-27)7-11-8-16(28)25-18(11)29/h7,9-10,13,23H,1-6,8H2,(H,25,28,29)/b11-7+ |
| InChIKey | RILNHMXIZABZRF-YRNVUSSQSA-N |
| XLogP | 1.97 |
| TPSA | 91.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|