C20H14F4N6O3 — CID 58314565
(3E)-3-[[4-(cyclopropylamino)-2-[2-fluoro-5-(trifluoromethyl)phenoxy]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58314565) has the molecular formula C20H14F4N6O3 and a molecular weight of 462.36 g/mol. Its IUPAC name is (3E)-3-[[4-(cyclopropylamino)-2-[2-fluoro-5-(trifluoromethyl)phenoxy]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-(cyclopropylamino)-2-[2-fluoro-5-(trifluoromethyl)phenoxy]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58314565 |
| Molecular Formula | C20H14F4N6O3 |
| Molecular Weight | 462.36 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | (3E)-3-[[4-(cyclopropylamino)-2-[2-fluoro-5-(trifluoromethyl)phenoxy]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(NC4CC4)nc(Oc4cc(C(F)(F)F)ccc4F)nc23)C(=O)N1 |
| InChI | InChI=1S/C20H14F4N6O3/c21-13-4-1-11(20(22,23)24)7-14(13)33-19-28-16-10(5-9-6-15(31)27-17(9)32)8-25-30(16)18(29-19)26-12-2-3-12/h1,4-5,7-8,12H,2-3,6H2,(H,26,28,29)(H,27,31,32)/b9-5+ |
| InChIKey | KECHPBQZDZAQFU-WEVVVXLNSA-N |
| XLogP | 3.08 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|