About 1-methyl-1-N,1-N-bis(prop-2-enyl)cyclohexane-1,4-diamine
1-methyl-1-N,1-N-bis(prop-2-enyl)cyclohexane-1,4-diamine (PubChem CID 58314575) has the molecular formula C13H24N2
and a molecular weight of 208.35 g/mol. Its IUPAC name is 1-methyl-1-N,1-N-bis(prop-2-enyl)cyclohexane-1,4-diamine.
Molecular Properties
| Compound Name | 1-methyl-1-N,1-N-bis(prop-2-enyl)cyclohexane-1,4-diamine |
| PubChem CID | 58314575 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 1-methyl-1-N,1-N-bis(prop-2-enyl)cyclohexane-1,4-diamine |
| SMILES | C=CCN(CC=C)C1(C)CCC(N)CC1 |
| InChI | InChI=1S/C13H24N2/c1-4-10-15(11-5-2)13(3)8-6-12(14)7-9-13/h4-5,12H,1-2,6-11,14H2,3H3 |
| InChIKey | KMHICGBNRIPBDQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-1-N,1-N-bis(prop-2-enyl)cyclohexane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-1-N,1-N-bis(prop-2-enyl)cyclohexane-1,4-diamine?
The IUPAC name of 1-methyl-1-N,1-N-bis(prop-2-enyl)cyclohexane-1,4-diamine (CID 58314575) is 1-methyl-1-N,1-N-bis(prop-2-enyl)cyclohexane-1,4-diamine.
What is the SMILES notation for 1-methyl-1-N,1-N-bis(prop-2-enyl)cyclohexane-1,4-diamine?
The canonical SMILES for 1-methyl-1-N,1-N-bis(prop-2-enyl)cyclohexane-1,4-diamine is C=CCN(CC=C)C1(C)CCC(N)CC1.
What is the InChIKey of 1-methyl-1-N,1-N-bis(prop-2-enyl)cyclohexane-1,4-diamine?
The InChIKey is KMHICGBNRIPBDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2/c1-4-10-15(11-5-2)13(3)8-6-12(14)7-9-13/h4-5,12H,1-2,6-11,14H2,3H3.
What are the key properties of 1-methyl-1-N,1-N-bis(prop-2-enyl)cyclohexane-1,4-diamine?
1-methyl-1-N,1-N-bis(prop-2-enyl)cyclohexane-1,4-diamine has a molecular weight of 208.35 g/mol, XLogP of 2.32, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1-N,1-N-bis(prop-2-enyl)cyclohexane-1,4-diamine is sourced from PubChem (CID 58314575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).