C21H18F3N7O3 — CID 58314621
(3E)-3-[[4-(cyclopropylamino)-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58314621) has the molecular formula C21H18F3N7O3 and a molecular weight of 473.42 g/mol. Its IUPAC name is (3E)-3-[[4-(cyclopropylamino)-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-(cyclopropylamino)-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58314621 |
| Molecular Formula | C21H18F3N7O3 |
| Molecular Weight | 473.42 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | (3E)-3-[[4-(cyclopropylamino)-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(NC4CC4)nc(NCc4cccc(OC(F)(F)F)c4)nc23)C(=O)N1 |
| InChI | InChI=1S/C21H18F3N7O3/c22-21(23,24)34-15-3-1-2-11(6-15)9-25-19-29-17-13(7-12-8-16(32)28-18(12)33)10-26-31(17)20(30-19)27-14-4-5-14/h1-3,6-7,10,14H,4-5,8-9H2,(H,28,32,33)(H2,25,27,29,30)/b12-7+ |
| InChIKey | SMBRLHBDWWNBIP-KPKJPENVSA-N |
| XLogP | 2.64 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|