C17H12ClFN6O2 — CID 58314659
(3E)-3-[[7-amino-5-(5-chloro-2-fluoroanilino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58314659) has the molecular formula C17H12ClFN6O2 and a molecular weight of 386.77 g/mol. Its IUPAC name is (3E)-3-[[7-amino-5-(5-chloro-2-fluoroanilino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[7-amino-5-(5-chloro-2-fluoroanilino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58314659 |
| Molecular Formula | C17H12ClFN6O2 |
| Molecular Weight | 386.77 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | (3E)-3-[[7-amino-5-(5-chloro-2-fluoroanilino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | Nc1cc(Nc2cc(Cl)ccc2F)nc2c(/C=C3\CC(=O)NC3=O)cnn12 |
| InChI | InChI=1S/C17H12ClFN6O2/c18-10-1-2-11(19)12(5-10)22-14-6-13(20)25-16(23-14)9(7-21-25)3-8-4-15(26)24-17(8)27/h1-3,5-7H,4,20H2,(H,22,23)(H,24,26,27)/b8-3+ |
| InChIKey | JQZXCMCTEKIIGS-FPYGCLRLSA-N |
| XLogP | 2.28 |
| TPSA | 114.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.77 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|