C21H16N6O3 — CID 58314696
(3E)-3-[[4-(cyclopropylamino)-2-(3-ethynylphenoxy)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58314696) has the molecular formula C21H16N6O3 and a molecular weight of 400.40 g/mol. Its IUPAC name is (3E)-3-[[4-(cyclopropylamino)-2-(3-ethynylphenoxy)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-(cyclopropylamino)-2-(3-ethynylphenoxy)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58314696 |
| Molecular Formula | C21H16N6O3 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | (3E)-3-[[4-(cyclopropylamino)-2-(3-ethynylphenoxy)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | C#Cc1cccc(Oc2nc(NC3CC3)n3ncc(/C=C4\CC(=O)NC4=O)c3n2)c1 |
| InChI | InChI=1S/C21H16N6O3/c1-2-12-4-3-5-16(8-12)30-21-25-18-14(9-13-10-17(28)24-19(13)29)11-22-27(18)20(26-21)23-15-6-7-15/h1,3-5,8-9,11,15H,6-7,10H2,(H,23,25,26)(H,24,28,29)/b13-9+ |
| InChIKey | BRLVKAKBBXZURE-UKTHLTGXSA-N |
| XLogP | 1.90 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|