C21H20F3N7O4 — CID 58314874
(3E)-3-[[4-(2-ethoxyethylamino)-2-[3-(trifluoromethoxy)anilino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58314874) has the molecular formula C21H20F3N7O4 and a molecular weight of 491.43 g/mol. Its IUPAC name is (3E)-3-[[4-(2-ethoxyethylamino)-2-[3-(trifluoromethoxy)anilino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-(2-ethoxyethylamino)-2-[3-(trifluoromethoxy)anilino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58314874 |
| Molecular Formula | C21H20F3N7O4 |
| Molecular Weight | 491.43 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | (3E)-3-[[4-(2-ethoxyethylamino)-2-[3-(trifluoromethoxy)anilino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | CCOCCNc1nc(Nc2cccc(OC(F)(F)F)c2)nc2c(/C=C3\CC(=O)NC3=O)cnn12 |
| InChI | InChI=1S/C21H20F3N7O4/c1-2-34-7-6-25-20-30-19(27-14-4-3-5-15(10-14)35-21(22,23)24)29-17-13(11-26-31(17)20)8-12-9-16(32)28-18(12)33/h3-5,8,10-11H,2,6-7,9H2,1H3,(H,28,32,33)(H2,25,27,29,30)/b12-8+ |
| InChIKey | XIQLOAKIFDFXAZ-XYOKQWHBSA-N |
| XLogP | 2.64 |
| TPSA | 131.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|