C17H21N7O2 — CID 58314961
(3E)-3-[[4-(cyclopropylamino)-2-(2-methylpropylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58314961) has the molecular formula C17H21N7O2 and a molecular weight of 355.40 g/mol. Its IUPAC name is (3E)-3-[[4-(cyclopropylamino)-2-(2-methylpropylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-(cyclopropylamino)-2-(2-methylpropylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58314961 |
| Molecular Formula | C17H21N7O2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | (3E)-3-[[4-(cyclopropylamino)-2-(2-methylpropylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | CC(C)CNc1nc(NC2CC2)n2ncc(/C=C3\CC(=O)NC3=O)c2n1 |
| InChI | InChI=1S/C17H21N7O2/c1-9(2)7-18-16-22-14-11(5-10-6-13(25)21-15(10)26)8-19-24(14)17(23-16)20-12-3-4-12/h5,8-9,12H,3-4,6-7H2,1-2H3,(H,21,25,26)(H2,18,20,22,23)/b10-5+ |
| InChIKey | HFAPUVYBQYGJLQ-BJMVGYQFSA-N |
| XLogP | 1.20 |
| TPSA | 113.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|