C24H25N5O4S — CID 58315063
(3E)-3-[[7-(cyclopropylamino)-5-[5-(6-hydroxyhexanoyl)thiophen-2-yl]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58315063) has the molecular formula C24H25N5O4S and a molecular weight of 479.56 g/mol. Its IUPAC name is (3E)-3-[[7-(cyclopropylamino)-5-[5-(6-hydroxyhexanoyl)thiophen-2-yl]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[7-(cyclopropylamino)-5-[5-(6-hydroxyhexanoyl)thiophen-2-yl]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58315063 |
| Molecular Formula | C24H25N5O4S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | (3E)-3-[[7-(cyclopropylamino)-5-[5-(6-hydroxyhexanoyl)thiophen-2-yl]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(NC4CC4)cc(-c4ccc(C(=O)CCCCCO)s4)nc23)C(=O)N1 |
| InChI | InChI=1S/C24H25N5O4S/c30-9-3-1-2-4-18(31)20-8-7-19(34-20)17-12-21(26-16-5-6-16)29-23(27-17)15(13-25-29)10-14-11-22(32)28-24(14)33/h7-8,10,12-13,16,26,30H,1-6,9,11H2,(H,28,32,33)/b14-10+ |
| InChIKey | UTKBJHOLYYKYAK-GXDHUFHOSA-N |
| XLogP | 3.20 |
| TPSA | 125.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|