C22H23N7O2 — CID 58315105
(3E)-3-[[4-(cyclopropylamino)-2-[methyl-[(1R)-1-phenylethyl]amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58315105) has the molecular formula C22H23N7O2 and a molecular weight of 417.47 g/mol. Its IUPAC name is (3E)-3-[[4-(cyclopropylamino)-2-[methyl-[(1R)-1-phenylethyl]amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-(cyclopropylamino)-2-[methyl-[(1R)-1-phenylethyl]amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58315105 |
| Molecular Formula | C22H23N7O2 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | (3E)-3-[[4-(cyclopropylamino)-2-[methyl-[(1R)-1-phenylethyl]amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | C[C@H](c1ccccc1)N(C)c1nc(NC2CC2)n2ncc(/C=C3\CC(=O)NC3=O)c2n1 |
| InChI | InChI=1S/C22H23N7O2/c1-13(14-6-4-3-5-7-14)28(2)21-26-19-16(10-15-11-18(30)25-20(15)31)12-23-29(19)22(27-21)24-17-8-9-17/h3-7,10,12-13,17H,8-9,11H2,1-2H3,(H,24,26,27)(H,25,30,31)/b15-10+/t13-/m1/s1 |
| InChIKey | IAQAOETZTAKVIP-QQFZQELXSA-N |
| XLogP | 2.33 |
| TPSA | 104.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|