C20H22F2N6O2 — CID 58315169
(3E)-3-[[7-(cyclopropylamino)-5-[(4,4-difluorocyclohexyl)amino]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58315169) has the molecular formula C20H22F2N6O2 and a molecular weight of 416.43 g/mol. Its IUPAC name is (3E)-3-[[7-(cyclopropylamino)-5-[(4,4-difluorocyclohexyl)amino]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[7-(cyclopropylamino)-5-[(4,4-difluorocyclohexyl)amino]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58315169 |
| Molecular Formula | C20H22F2N6O2 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | (3E)-3-[[7-(cyclopropylamino)-5-[(4,4-difluorocyclohexyl)amino]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(NC4CC4)cc(NC4CCC(F)(F)CC4)nc23)C(=O)N1 |
| InChI | InChI=1S/C20H22F2N6O2/c21-20(22)5-3-14(4-6-20)24-15-9-16(25-13-1-2-13)28-18(26-15)12(10-23-28)7-11-8-17(29)27-19(11)30/h7,9-10,13-14,25H,1-6,8H2,(H,24,26)(H,27,29,30)/b11-7+ |
| InChIKey | SWLPSTHQLLHTGV-YRNVUSSQSA-N |
| XLogP | 2.72 |
| TPSA | 100.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|