C15H19N — CID 58315233
10-propan-2-yl-6,7,8,9-tetrahydropyrido[1,2-a]indole (PubChem CID 58315233) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is 10-propan-2-yl-6,7,8,9-tetrahydropyrido[1,2-a]indole.
| Compound Name | 10-propan-2-yl-6,7,8,9-tetrahydropyrido[1,2-a]indole |
|---|---|
| PubChem CID | 58315233 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 10-propan-2-yl-6,7,8,9-tetrahydropyrido[1,2-a]indole |
| SMILES | CC(C)c1c2n(c3ccccc13)CCCC2 |
| InChI | InChI=1S/C15H19N/c1-11(2)15-12-7-3-4-8-13(12)16-10-6-5-9-14(15)16/h3-4,7-8,11H,5-6,9-10H2,1-2H3 |
| InChIKey | QMXWIJCOIMMUGC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|