C24H22N6O2S — CID 58315316
3-[2-(4-amino-4-methylpiperidin-1-yl)quinazolin-4-yl]-4-(6H-thieno[2,3-b]pyrrol-4-yl)pyrrole-2,5-dione (PubChem CID 58315316) has the molecular formula C24H22N6O2S and a molecular weight of 458.55 g/mol. Its IUPAC name is 3-[2-(4-amino-4-methylpiperidin-1-yl)quinazolin-4-yl]-4-(6H-thieno[2,3-b]pyrrol-4-yl)pyrrole-2,5-dione.
| Compound Name | 3-[2-(4-amino-4-methylpiperidin-1-yl)quinazolin-4-yl]-4-(6H-thieno[2,3-b]pyrrol-4-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 58315316 |
| Molecular Formula | C24H22N6O2S |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 3-[2-(4-amino-4-methylpiperidin-1-yl)quinazolin-4-yl]-4-(6H-thieno[2,3-b]pyrrol-4-yl)pyrrole-2,5-dione |
| SMILES | CC1(N)CCN(c2nc(C3=C(c4c[nH]c5sccc45)C(=O)NC3=O)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C24H22N6O2S/c1-24(25)7-9-30(10-8-24)23-27-16-5-3-2-4-14(16)19(28-23)18-17(20(31)29-21(18)32)15-12-26-22-13(15)6-11-33-22/h2-6,11-12,26H,7-10,25H2,1H3,(H,29,31,32) |
| InChIKey | DQKXJRZSGXOZIJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|